C29H27BrN4O5 — CID 5211946
[4-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate (PubChem CID 5211946) has the molecular formula C29H27BrN4O5 and a molecular weight of 591.46 g/mol. Its IUPAC name is [4-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate.
| Compound Name | [4-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 5211946 |
| Molecular Formula | C29H27BrN4O5 |
| Molecular Weight | 591.46 g/mol |
| Exact Mass | 590.12 |
| IUPAC Name | [4-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate |
| SMILES | O=C(NN=Cc1ccc(OC(=O)c2cccc(Br)c2)cc1)C(=O)Nc1ccccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C29H27BrN4O5/c30-21-8-6-7-20(17-21)29(38)39-23-15-13-19(14-16-23)18-31-34-28(37)27(36)33-25-12-5-4-11-24(25)26(35)32-22-9-2-1-3-10-22/h4-8,11-18,22H,1-3,9-10H2,(H,32,35)(H,33,36)(H,34,37) |
| InChIKey | NQYZCVKTPAURGN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|