C21H15BrN2O4 — CID 3844710
[4-[[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-bromobenzoate (PubChem CID 3844710) has the molecular formula C21H15BrN2O4 and a molecular weight of 439.27 g/mol. Its IUPAC name is [4-[[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-bromobenzoate.
| Compound Name | [4-[[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 3844710 |
| Molecular Formula | C21H15BrN2O4 |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | [4-[[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-bromobenzoate |
| SMILES | O=C(Oc1ccc(C=NNC(=O)c2ccccc2O)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C21H15BrN2O4/c22-16-5-3-4-15(12-16)21(27)28-17-10-8-14(9-11-17)13-23-24-20(26)18-6-1-2-7-19(18)25/h1-13,25H,(H,24,26) |
| InChIKey | YXKLDRBUUCPVKH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|