C21H14Br3N3O3 — CID 4052668
[4-[[(2-amino-3,5-dibromobenzoyl)hydrazinylidene]methyl]phenyl] 3-bromobenzoate (PubChem CID 4052668) has the molecular formula C21H14Br3N3O3 and a molecular weight of 596.07 g/mol. Its IUPAC name is [4-[[(2-amino-3,5-dibromobenzoyl)hydrazinylidene]methyl]phenyl] 3-bromobenzoate.
| Compound Name | [4-[[(2-amino-3,5-dibromobenzoyl)hydrazinylidene]methyl]phenyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 4052668 |
| Molecular Formula | C21H14Br3N3O3 |
| Molecular Weight | 596.07 g/mol |
| Exact Mass | 592.86 |
| IUPAC Name | [4-[[(2-amino-3,5-dibromobenzoyl)hydrazinylidene]methyl]phenyl] 3-bromobenzoate |
| SMILES | Nc1c(Br)cc(Br)cc1C(=O)NN=Cc1ccc(OC(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C21H14Br3N3O3/c22-14-3-1-2-13(8-14)21(29)30-16-6-4-12(5-7-16)11-26-27-20(28)17-9-15(23)10-18(24)19(17)25/h1-11H,25H2,(H,27,28) |
| InChIKey | KWPHYCAINREWKL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.07 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|