C31H31ClN4O6 — CID 4225711
[4-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate (PubChem CID 4225711) has the molecular formula C31H31ClN4O6 and a molecular weight of 591.06 g/mol. Its IUPAC name is [4-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4225711 |
| Molecular Formula | C31H31ClN4O6 |
| Molecular Weight | 591.06 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | [4-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate |
| SMILES | CCOc1cc(C=NNC(=O)C(=O)Nc2ccccc2C(=O)NC2CCCCC2)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H31ClN4O6/c1-2-41-27-18-20(12-17-26(27)42-31(40)21-13-15-22(32)16-14-21)19-33-36-30(39)29(38)35-25-11-7-6-10-24(25)28(37)34-23-8-4-3-5-9-23/h6-7,10-19,23H,2-5,8-9H2,1H3,(H,34,37)(H,35,38)(H,36,39) |
| InChIKey | ZHSNRJHZYNOWNE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.06 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|