C35H34N4O7 — CID 45054830
[1-[(E)-[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 3,4-dimethoxybenzoate (PubChem CID 45054830) has the molecular formula C35H34N4O7 and a molecular weight of 622.68 g/mol. Its IUPAC name is [1-[(E)-[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 3,4-dimethoxybenzoate.
| Compound Name | [1-[(E)-[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 45054830 |
| Molecular Formula | C35H34N4O7 |
| Molecular Weight | 622.68 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | [1-[(E)-[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3ccccc3c2/C=N/NC(=O)C(=O)Nc2ccccc2C(=O)NC2CCCCC2)cc1OC |
| InChI | InChI=1S/C35H34N4O7/c1-44-30-19-17-23(20-31(30)45-2)35(43)46-29-18-16-22-10-6-7-13-25(22)27(29)21-36-39-34(42)33(41)38-28-15-9-8-14-26(28)32(40)37-24-11-4-3-5-12-24/h6-10,13-21,24H,3-5,11-12H2,1-2H3,(H,37,40)(H,38,41)(H,39,42)/b36-21+ |
| InChIKey | KCSMJAFMGVAAQZ-QLQYKETESA-N |
| XLogP | 5.23 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|