C22H24N4O5 — CID 4207988
N-[2-(cyclohexylcarbamoyl)phenyl]-N'-[(2,4-dihydroxyphenyl)methylideneamino]oxamide (PubChem CID 4207988) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is N-[2-(cyclohexylcarbamoyl)phenyl]-N'-[(2,4-dihydroxyphenyl)methylideneamino]oxamide.
| Compound Name | N-[2-(cyclohexylcarbamoyl)phenyl]-N'-[(2,4-dihydroxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 4207988 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[2-(cyclohexylcarbamoyl)phenyl]-N'-[(2,4-dihydroxyphenyl)methylideneamino]oxamide |
| SMILES | O=C(NN=Cc1ccc(O)cc1O)C(=O)Nc1ccccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H24N4O5/c27-16-11-10-14(19(28)12-16)13-23-26-22(31)21(30)25-18-9-5-4-8-17(18)20(29)24-15-6-2-1-3-7-15/h4-5,8-13,15,27-28H,1-3,6-7H2,(H,24,29)(H,25,30)(H,26,31) |
| InChIKey | ZSZMDMXVOJUZBT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|