C24H20ClN3O6 — CID 19661790
[3-[(E)-[[2-(5-chloro-2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-methoxybenzoate (PubChem CID 19661790) has the molecular formula C24H20ClN3O6 and a molecular weight of 481.89 g/mol. Its IUPAC name is [3-[(E)-[[2-(5-chloro-2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-methoxybenzoate.
| Compound Name | [3-[(E)-[[2-(5-chloro-2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 19661790 |
| Molecular Formula | C24H20ClN3O6 |
| Molecular Weight | 481.89 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | [3-[(E)-[[2-(5-chloro-2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(=O)N/N=C/c1cccc(OC(=O)c2ccccc2OC)c1 |
| InChI | InChI=1S/C24H20ClN3O6/c1-32-20-9-4-3-8-18(20)24(31)34-17-7-5-6-15(12-17)14-26-28-23(30)22(29)27-19-13-16(25)10-11-21(19)33-2/h3-14H,1-2H3,(H,27,29)(H,28,30)/b26-14+ |
| InChIKey | MRXJXUMBEWOXKH-VULFUBBASA-N |
| XLogP | 3.67 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.89 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|