C24H20BrN3O6 — CID 19661053
[3-[(E)-[[2-(2,4-dimethoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate (PubChem CID 19661053) has the molecular formula C24H20BrN3O6 and a molecular weight of 526.34 g/mol. Its IUPAC name is [3-[(E)-[[2-(2,4-dimethoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate.
| Compound Name | [3-[(E)-[[2-(2,4-dimethoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 19661053 |
| Molecular Formula | C24H20BrN3O6 |
| Molecular Weight | 526.34 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | [3-[(E)-[[2-(2,4-dimethoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate |
| SMILES | COc1ccc(NC(=O)C(=O)N/N=C/c2cccc(OC(=O)c3ccccc3Br)c2)c(OC)c1 |
| InChI | InChI=1S/C24H20BrN3O6/c1-32-16-10-11-20(21(13-16)33-2)27-22(29)23(30)28-26-14-15-6-5-7-17(12-15)34-24(31)18-8-3-4-9-19(18)25/h3-14H,1-2H3,(H,27,29)(H,28,30)/b26-14+ |
| InChIKey | IIOCFYWQNNDWFY-VULFUBBASA-N |
| XLogP | 3.77 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|