C14H12F2N6O6 — CID 19298166
[(Z)-[amino-(4-nitrophenyl)methylidene]amino] 2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetate (PubChem CID 19298166) has the molecular formula C14H12F2N6O6 and a molecular weight of 398.28 g/mol. Its IUPAC name is [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetate.
| Compound Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 19298166 |
| Molecular Formula | C14H12F2N6O6 |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetate |
| SMILES | Cc1c([N+](=O)[O-])c(C(F)F)nn1CC(=O)O/N=C(\N)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H12F2N6O6/c1-7-12(22(26)27)11(13(15)16)18-20(7)6-10(23)28-19-14(17)8-2-4-9(5-3-8)21(24)25/h2-5,13H,6H2,1H3,(H2,17,19) |
| InChIKey | SANTUAHEXWKLNV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 168.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|