C15H16ClN3O4 — CID 7869554
[(1R)-1-(2-chlorophenyl)ethyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 7869554) has the molecular formula C15H16ClN3O4 and a molecular weight of 337.76 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 7869554 |
| Molecular Formula | C15H16ClN3O4 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | Cc1nn(CC(=O)O[C@H](C)c2ccccc2Cl)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16ClN3O4/c1-9-15(19(21)22)10(2)18(17-9)8-14(20)23-11(3)12-6-4-5-7-13(12)16/h4-7,11H,8H2,1-3H3/t11-/m1/s1 |
| InChIKey | FCQQSIWUXWSZEY-LLVKDONJSA-N |
| XLogP | 3.37 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|