C16H16Cl2N4O5 — CID 7869324
[(2S)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 7869324) has the molecular formula C16H16Cl2N4O5 and a molecular weight of 415.23 g/mol. Its IUPAC name is [(2S)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | [(2S)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 7869324 |
| Molecular Formula | C16H16Cl2N4O5 |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | [(2S)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | Cc1nn(CC(=O)O[C@@H](C)C(=O)Nc2cc(Cl)ccc2Cl)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16Cl2N4O5/c1-8-15(22(25)26)9(2)21(20-8)7-14(23)27-10(3)16(24)19-13-6-11(17)4-5-12(13)18/h4-6,10H,7H2,1-3H3,(H,19,24)/t10-/m0/s1 |
| InChIKey | HNASCEYDPZKGOE-JTQLQIEISA-N |
| XLogP | 3.29 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|