C17H15N7O4 — CID 44726598
2-(2-nitrophenoxy)-N-[(E)-1-[3-(tetrazol-1-yl)phenyl]ethylideneamino]acetamide (PubChem CID 44726598) has the molecular formula C17H15N7O4 and a molecular weight of 381.35 g/mol. Its IUPAC name is 2-(2-nitrophenoxy)-N-[(E)-1-[3-(tetrazol-1-yl)phenyl]ethylideneamino]acetamide.
| Compound Name | 2-(2-nitrophenoxy)-N-[(E)-1-[3-(tetrazol-1-yl)phenyl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 44726598 |
| Molecular Formula | C17H15N7O4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-(2-nitrophenoxy)-N-[(E)-1-[3-(tetrazol-1-yl)phenyl]ethylideneamino]acetamide |
| SMILES | C/C(=N\NC(=O)COc1ccccc1[N+](=O)[O-])c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C17H15N7O4/c1-12(13-5-4-6-14(9-13)23-11-18-21-22-23)19-20-17(25)10-28-16-8-3-2-7-15(16)24(26)27/h2-9,11H,10H2,1H3,(H,20,25)/b19-12+ |
| InChIKey | KERPTEMMNXFCKL-XDHOZWIPSA-N |
| XLogP | 1.49 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|