C17H17Cl2N3O3 — CID 135612298
N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-(4-methoxyanilino)acetamide (PubChem CID 135612298) has the molecular formula C17H17Cl2N3O3 and a molecular weight of 382.25 g/mol. Its IUPAC name is N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-(4-methoxyanilino)acetamide.
| Compound Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-(4-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 135612298 |
| Molecular Formula | C17H17Cl2N3O3 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-(4-methoxyanilino)acetamide |
| SMILES | COc1ccc(NCC(=O)N/N=C(\C)c2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C17H17Cl2N3O3/c1-10(14-7-11(18)8-15(19)17(14)24)21-22-16(23)9-20-12-3-5-13(25-2)6-4-12/h3-8,20,24H,9H2,1-2H3,(H,22,23)/b21-10+ |
| InChIKey | OJTQXHYFYLMDJT-UFFVCSGVSA-N |
| XLogP | 3.66 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|