C16H16Cl2N2O5S — CID 135647669
N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2,5-dimethoxybenzenesulfonamide (PubChem CID 135647669) has the molecular formula C16H16Cl2N2O5S and a molecular weight of 419.29 g/mol. Its IUPAC name is N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 135647669 |
| Molecular Formula | C16H16Cl2N2O5S |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N/N=C(\C)c2cc(Cl)cc(Cl)c2O)c1 |
| InChI | InChI=1S/C16H16Cl2N2O5S/c1-9(12-6-10(17)7-13(18)16(12)21)19-20-26(22,23)15-8-11(24-2)4-5-14(15)25-3/h4-8,20-21H,1-3H3/b19-9+ |
| InChIKey | JQLBGVWYKUPQEY-DJKKODMXSA-N |
| XLogP | 3.42 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|