C27H31N3O5S — CID 23100951
4-tert-butyl-N-[4-[(Z)-N-[(2,5-dimethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]benzamide (PubChem CID 23100951) has the molecular formula C27H31N3O5S and a molecular weight of 509.63 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[(Z)-N-[(2,5-dimethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[(Z)-N-[(2,5-dimethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23100951 |
| Molecular Formula | C27H31N3O5S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 4-tert-butyl-N-[4-[(Z)-N-[(2,5-dimethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]benzamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N/N=C(/C)c2ccc(NC(=O)c3ccc(C(C)(C)C)cc3)cc2)c1 |
| InChI | InChI=1S/C27H31N3O5S/c1-18(29-30-36(32,33)25-17-23(34-5)15-16-24(25)35-6)19-9-13-22(14-10-19)28-26(31)20-7-11-21(12-8-20)27(2,3)4/h7-17,30H,1-6H3,(H,28,31)/b29-18- |
| InChIKey | CEBXOZILSYPOLI-MIXAMLLLSA-N |
| XLogP | 4.96 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|