C24H29N3O7S — CID 17337916
2-[[4-[(E)-N-[(2,5-dimethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 17337916) has the molecular formula C24H29N3O7S and a molecular weight of 503.58 g/mol. Its IUPAC name is 2-[[4-[(E)-N-[(2,5-dimethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[[4-[(E)-N-[(2,5-dimethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 17337916 |
| Molecular Formula | C24H29N3O7S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 2-[[4-[(E)-N-[(2,5-dimethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N/N=C(\C)c2ccc(NC(=O)C3CCCCC3C(=O)O)cc2)c1 |
| InChI | InChI=1S/C24H29N3O7S/c1-15(26-27-35(31,32)22-14-18(33-2)12-13-21(22)34-3)16-8-10-17(11-9-16)25-23(28)19-6-4-5-7-20(19)24(29)30/h8-14,19-20,27H,4-7H2,1-3H3,(H,25,28)(H,29,30)/b26-15+ |
| InChIKey | AGMBLDROBTUITG-CVKSISIWSA-N |
| XLogP | 3.24 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|