C18H23N3O5S — CID 110407286
2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 110407286) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 110407286 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCC(=O)Nc2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C18H23N3O5S/c1-21(2)14-7-5-13(6-8-14)20-18(22)12-19-27(23,24)17-11-15(25-3)9-10-16(17)26-4/h5-11,19H,12H2,1-4H3,(H,20,22) |
| InChIKey | STDHSPPUDZBBJT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|