C19H25N3O4S — CID 110407309
N-[4-(dimethylamino)phenyl]-2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]acetamide (PubChem CID 110407309) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 110407309 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]acetamide |
| SMILES | COc1cc(C)c(S(=O)(=O)NCC(=O)Nc2ccc(N(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C19H25N3O4S/c1-13-10-17(26-5)11-14(2)19(13)27(24,25)20-12-18(23)21-15-6-8-16(9-7-15)22(3)4/h6-11,20H,12H2,1-5H3,(H,21,23) |
| InChIKey | SWODBWVOMLVHQD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|