C16H17ClN2O5S — CID 135958231
N-[(Z)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-2,4-dimethoxybenzenesulfonamide (PubChem CID 135958231) has the molecular formula C16H17ClN2O5S and a molecular weight of 384.84 g/mol. Its IUPAC name is N-[(Z)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[(Z)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 135958231 |
| Molecular Formula | C16H17ClN2O5S |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-[(Z)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N/N=C(/C)c2cc(Cl)ccc2O)c(OC)c1 |
| InChI | InChI=1S/C16H17ClN2O5S/c1-10(13-8-11(17)4-6-14(13)20)18-19-25(21,22)16-7-5-12(23-2)9-15(16)24-3/h4-9,19-20H,1-3H3/b18-10- |
| InChIKey | CUYCIHPHYSFYRB-ZDLGFXPLSA-N |
| XLogP | 2.77 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|