C17H17ClN2O5 — CID 9297823
5-chloro-2-hydroxy-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 9297823) has the molecular formula C17H17ClN2O5 and a molecular weight of 364.79 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 5-chloro-2-hydroxy-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 9297823 |
| Molecular Formula | C17H17ClN2O5 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 5-chloro-2-hydroxy-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(OC)c(/C=N\NC(=O)c2cc(Cl)ccc2O)c(OC)c1 |
| InChI | InChI=1S/C17H17ClN2O5/c1-23-11-7-15(24-2)13(16(8-11)25-3)9-19-20-17(22)12-6-10(18)4-5-14(12)21/h4-9,21H,1-3H3,(H,20,22)/b19-9- |
| InChIKey | XGSWRRDEDUDKJZ-OCKHKDLRSA-N |
| XLogP | 2.84 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|