C16H14F2N2O4 — CID 135455777
2,6-difluoro-N-[(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]benzamide (PubChem CID 135455777) has the molecular formula C16H14F2N2O4 and a molecular weight of 336.29 g/mol. Its IUPAC name is 2,6-difluoro-N-[(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 2,6-difluoro-N-[(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135455777 |
| Molecular Formula | C16H14F2N2O4 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2,6-difluoro-N-[(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(O)c(C=NNC(=O)c2c(F)cccc2F)c(OC)c1 |
| InChI | InChI=1S/C16H14F2N2O4/c1-23-9-6-13(21)10(14(7-9)24-2)8-19-20-16(22)15-11(17)4-3-5-12(15)18/h3-8,21H,1-2H3,(H,20,22) |
| InChIKey | RJCJFEJEPNNONF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|