C23H22N4O4S2 — CID 18899103
N-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl]sulfanylphenyl]cyclopropanecarboxamide (PubChem CID 18899103) has the molecular formula C23H22N4O4S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is N-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl]sulfanylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl]sulfanylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 18899103 |
| Molecular Formula | C23H22N4O4S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | N-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl]sulfanylphenyl]cyclopropanecarboxamide |
| SMILES | CCC(Sc1cccc(NC(=O)C2CC2)c1)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C23H22N4O4S2/c1-2-20(33-18-8-4-6-16(12-18)24-21(28)14-9-10-14)22(29)26-23-25-19(13-32-23)15-5-3-7-17(11-15)27(30)31/h3-8,11-14,20H,2,9-10H2,1H3,(H,24,28)(H,25,26,29) |
| InChIKey | ZWICKRDSORUUNS-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|