C36H31N5O5S2 — CID 19304200
N-[(Z)-1-(4-methylphenyl)-3-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19304200) has the molecular formula C36H31N5O5S2 and a molecular weight of 677.81 g/mol. Its IUPAC name is N-[(Z)-1-(4-methylphenyl)-3-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-methylphenyl)-3-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19304200 |
| Molecular Formula | C36H31N5O5S2 |
| Molecular Weight | 677.81 g/mol |
| Exact Mass | 677.18 |
| IUPAC Name | N-[(Z)-1-(4-methylphenyl)-3-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2ccc(C)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C36H31N5O5S2/c1-3-32(35(44)40-36-39-31(22-47-36)26-11-7-13-28(20-26)41(45)46)48-29-14-8-12-27(21-29)37-34(43)30(19-24-17-15-23(2)16-18-24)38-33(42)25-9-5-4-6-10-25/h4-22,32H,3H2,1-2H3,(H,37,43)(H,38,42)(H,39,40,44)/b30-19- |
| InChIKey | VELRCDADOLWXQB-FSGOGVSDSA-N |
| XLogP | 7.95 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.81 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|