C25H28N6O5S — CID 3909535
N-[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 3909535) has the molecular formula C25H28N6O5S and a molecular weight of 524.60 g/mol. Its IUPAC name is N-[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3909535 |
| Molecular Formula | C25H28N6O5S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | N-[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CC(C)(C)C(=O)N1CCN(c2ccc(NC(=O)CSc3nnc(-c4ccc([N+](=O)[O-])cc4)o3)cc2)CC1 |
| InChI | InChI=1S/C25H28N6O5S/c1-25(2,3)23(33)30-14-12-29(13-15-30)19-10-6-18(7-11-19)26-21(32)16-37-24-28-27-22(36-24)17-4-8-20(9-5-17)31(34)35/h4-11H,12-16H2,1-3H3,(H,26,32) |
| InChIKey | HSRHVLCZSFGPCU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|