C7H10N4OS2 — CID 65216211
N-(1-amino-1-sulfanylidenebutan-2-yl)thiadiazole-4-carboxamide (PubChem CID 65216211) has the molecular formula C7H10N4OS2 and a molecular weight of 230.32 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenebutan-2-yl)thiadiazole-4-carboxamide.
| Compound Name | N-(1-amino-1-sulfanylidenebutan-2-yl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 65216211 |
| Molecular Formula | C7H10N4OS2 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | N-(1-amino-1-sulfanylidenebutan-2-yl)thiadiazole-4-carboxamide |
| SMILES | CCC(NC(=O)c1csnn1)C(N)=S |
| InChI | InChI=1S/C7H10N4OS2/c1-2-4(6(8)13)9-7(12)5-3-14-11-10-5/h3-4H,2H2,1H3,(H2,8,13)(H,9,12) |
| InChIKey | WWBLANRZPVUHFS-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|