(2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid

C9H13N3O3S — CID 65214443

IUPAC(2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid
SMILESCC[C@H](C)[C@H](NC(=O)c1csnn1)C(=O)O
InChIInChI=1S/C9H13N3O3S/c1-3-5(2)7(9(14)15)10-8(13)6-4-16-12-11-6/h4-5,7H,3H2,1-2H3,(H,10,13)(H,14,15)/t5-,7-/m0/s1
InChIKeyJIPOWCURNKBJFJ-FSPLSTOPSA-N
MW243.29 g/mol
LogP0.77
Rot. Bonds5

About (2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid

(2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid (PubChem CID 65214443) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid.

Molecular Properties

Compound Name(2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid
PubChem CID65214443
Molecular FormulaC9H13N3O3S
Molecular Weight243.29 g/mol
Exact Mass243.07
IUPAC Name(2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid
SMILESCC[C@H](C)[C@H](NC(=O)c1csnn1)C(=O)O
InChIInChI=1S/C9H13N3O3S/c1-3-5(2)7(9(14)15)10-8(13)6-4-16-12-11-6/h4-5,7H,3H2,1-2H3,(H,10,13)(H,14,15)/t5-,7-/m0/s1
InChIKeyJIPOWCURNKBJFJ-FSPLSTOPSA-N
XLogP0.77
TPSA92.18 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.29
LogP ≤ 50.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze (2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid?
The IUPAC name of (2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid (CID 65214443) is (2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid.
What is the SMILES notation for (2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid?
The canonical SMILES for (2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid is CC[C@H](C)[C@H](NC(=O)c1csnn1)C(=O)O.
What is the InChIKey of (2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid?
The InChIKey is JIPOWCURNKBJFJ-FSPLSTOPSA-N. The full InChI is InChI=1S/C9H13N3O3S/c1-3-5(2)7(9(14)15)10-8(13)6-4-16-12-11-6/h4-5,7H,3H2,1-2H3,(H,10,13)(H,14,15)/t5-,7-/m0/s1.
What are the key properties of (2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid?
(2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid has a molecular weight of 243.29 g/mol, XLogP of 0.77, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-methyl-2-(thiadiazole-4-carbonylamino)pentanoic acid is sourced from PubChem (CID 65214443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).