C14H19N3O2S — CID 65349221
2-amino-N-(1-methoxypentan-2-yl)-1,3-benzothiazole-6-carboxamide (PubChem CID 65349221) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-amino-N-(1-methoxypentan-2-yl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-(1-methoxypentan-2-yl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 65349221 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-amino-N-(1-methoxypentan-2-yl)-1,3-benzothiazole-6-carboxamide |
| SMILES | CCCC(COC)NC(=O)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C14H19N3O2S/c1-3-4-10(8-19-2)16-13(18)9-5-6-11-12(7-9)20-14(15)17-11/h5-7,10H,3-4,8H2,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | UIKKSSOOPDZTQX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |