C22H26ClF3N4O — CID 22430304
1-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 22430304) has the molecular formula C22H26ClF3N4O and a molecular weight of 454.92 g/mol. Its IUPAC name is 1-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 22430304 |
| Molecular Formula | C22H26ClF3N4O |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 1-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccc(Cl)cc1N1CCN(CCCNC(=O)Nc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H26ClF3N4O/c1-16-7-8-17(23)15-20(16)30-13-11-29(12-14-30)10-4-9-27-21(31)28-19-6-3-2-5-18(19)22(24,25)26/h2-3,5-8,15H,4,9-14H2,1H3,(H2,27,28,31) |
| InChIKey | XIBZRRBVEUWMPD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|