C15H13F2N2OS+ — CID 4746768
3-[4-(difluoromethylsulfanyl)phenyl]-N-pyridin-1-ium-2-ylprop-2-enamide (PubChem CID 4746768) has the molecular formula C15H13F2N2OS+ and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-[4-(difluoromethylsulfanyl)phenyl]-N-pyridin-1-ium-2-ylprop-2-enamide.
| Compound Name | 3-[4-(difluoromethylsulfanyl)phenyl]-N-pyridin-1-ium-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4746768 |
| Molecular Formula | C15H13F2N2OS+ |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-[4-(difluoromethylsulfanyl)phenyl]-N-pyridin-1-ium-2-ylprop-2-enamide |
| SMILES | O=C(C=Cc1ccc(SC(F)F)cc1)Nc1cccc[nH+]1 |
| InChI | InChI=1S/C15H12F2N2OS/c16-15(17)21-12-7-4-11(5-8-12)6-9-14(20)19-13-3-1-2-10-18-13/h1-10,15H,(H,18,19,20)/p+1 |
| InChIKey | VCKFOFFZTNNXAG-UHFFFAOYSA-O |
| XLogP | 3.47 |
| TPSA | 43.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|