C19H22ClNO3 — CID 44564099
[2-methoxy-5-[(Z)-2-(3-methoxy-5-prop-2-enoxyphenyl)ethenyl]phenyl]azanium chloride (PubChem CID 44564099) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is [2-methoxy-5-[(Z)-2-(3-methoxy-5-prop-2-enoxyphenyl)ethenyl]phenyl]azanium chloride.
| Compound Name | [2-methoxy-5-[(Z)-2-(3-methoxy-5-prop-2-enoxyphenyl)ethenyl]phenyl]azanium chloride |
|---|---|
| PubChem CID | 44564099 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [2-methoxy-5-[(Z)-2-(3-methoxy-5-prop-2-enoxyphenyl)ethenyl]phenyl]azanium chloride |
| SMILES | C=CCOc1cc(/C=C\c2ccc(OC)c([NH3+])c2)cc(OC)c1.[Cl-] |
| InChI | InChI=1S/C19H21NO3.ClH/c1-4-9-23-17-11-15(10-16(13-17)21-2)6-5-14-7-8-19(22-3)18(20)12-14;/h4-8,10-13H,1,9,20H2,2-3H3;1H/b6-5-; |
| InChIKey | IIHJBWOYKJXCGN-YSMBQZINSA-N |
| XLogP | 0.32 |
| TPSA | 55.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|