C22H26O4 — CID 166173179
2-ethoxy-4-[2-[3-methoxy-5-(3-methylbut-2-enoxy)phenyl]ethenyl]phenol (PubChem CID 166173179) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-ethoxy-4-[2-[3-methoxy-5-(3-methylbut-2-enoxy)phenyl]ethenyl]phenol.
| Compound Name | 2-ethoxy-4-[2-[3-methoxy-5-(3-methylbut-2-enoxy)phenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 166173179 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-ethoxy-4-[2-[3-methoxy-5-(3-methylbut-2-enoxy)phenyl]ethenyl]phenol |
| SMILES | CCOc1cc(C=Cc2cc(OC)cc(OCC=C(C)C)c2)ccc1O |
| InChI | InChI=1S/C22H26O4/c1-5-25-22-14-17(8-9-21(22)23)6-7-18-12-19(24-4)15-20(13-18)26-11-10-16(2)3/h6-10,12-15,23H,5,11H2,1-4H3 |
| InChIKey | PJPJVAOUYDJMAG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|