C23H28O4 — CID 156539988
2-methoxy-4-[2-[3-(3-methylbut-2-enoxy)-5-propoxyphenyl]ethenyl]phenol (PubChem CID 156539988) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 2-methoxy-4-[2-[3-(3-methylbut-2-enoxy)-5-propoxyphenyl]ethenyl]phenol.
| Compound Name | 2-methoxy-4-[2-[3-(3-methylbut-2-enoxy)-5-propoxyphenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 156539988 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 2-methoxy-4-[2-[3-(3-methylbut-2-enoxy)-5-propoxyphenyl]ethenyl]phenol |
| SMILES | CCCOc1cc(C=Cc2ccc(O)c(OC)c2)cc(OCC=C(C)C)c1 |
| InChI | InChI=1S/C23H28O4/c1-5-11-26-20-13-19(14-21(16-20)27-12-10-17(2)3)7-6-18-8-9-22(24)23(15-18)25-4/h6-10,13-16,24H,5,11-12H2,1-4H3 |
| InChIKey | INTQTQUDAJKABT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|