C22H26O3 — CID 155539368
1,3-dimethoxy-5-[(E)-2-[4-methoxy-3-(2-methylbut-3-en-2-yl)phenyl]ethenyl]benzene (PubChem CID 155539368) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1,3-dimethoxy-5-[(E)-2-[4-methoxy-3-(2-methylbut-3-en-2-yl)phenyl]ethenyl]benzene.
| Compound Name | 1,3-dimethoxy-5-[(E)-2-[4-methoxy-3-(2-methylbut-3-en-2-yl)phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 155539368 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 1,3-dimethoxy-5-[(E)-2-[4-methoxy-3-(2-methylbut-3-en-2-yl)phenyl]ethenyl]benzene |
| SMILES | C=CC(C)(C)c1cc(/C=C/c2cc(OC)cc(OC)c2)ccc1OC |
| InChI | InChI=1S/C22H26O3/c1-7-22(2,3)20-14-16(10-11-21(20)25-6)8-9-17-12-18(23-4)15-19(13-17)24-5/h7-15H,1H2,2-6H3/b9-8+ |
| InChIKey | WPGJWPLBINMUCE-CMDGGOBGSA-N |
| XLogP | 5.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|