C22H28O5 — CID 23245430
1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-methylbutane-2,3-diol (PubChem CID 23245430) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-methylbutane-2,3-diol.
| Compound Name | 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-methylbutane-2,3-diol |
|---|---|
| PubChem CID | 23245430 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-methylbutane-2,3-diol |
| SMILES | COc1cc(/C=C/c2ccc(OC)c(CC(O)C(C)(C)O)c2)cc(OC)c1 |
| InChI | InChI=1S/C22H28O5/c1-22(2,24)21(23)13-17-10-15(8-9-20(17)27-5)6-7-16-11-18(25-3)14-19(12-16)26-4/h6-12,14,21,23-24H,13H2,1-5H3/b7-6+ |
| InChIKey | XPUFMWWCVOPELS-VOTSOKGWSA-N |
| XLogP | 3.56 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|