C18H22NO2+ — CID 58281563
[2-methoxy-5-[(Z)-2-(3-methoxy-4,5-dimethylphenyl)ethenyl]phenyl]azanium (PubChem CID 58281563) has the molecular formula C18H22NO2+ and a molecular weight of 284.38 g/mol. Its IUPAC name is [2-methoxy-5-[(Z)-2-(3-methoxy-4,5-dimethylphenyl)ethenyl]phenyl]azanium.
| Compound Name | [2-methoxy-5-[(Z)-2-(3-methoxy-4,5-dimethylphenyl)ethenyl]phenyl]azanium |
|---|---|
| PubChem CID | 58281563 |
| Molecular Formula | C18H22NO2+ |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [2-methoxy-5-[(Z)-2-(3-methoxy-4,5-dimethylphenyl)ethenyl]phenyl]azanium |
| SMILES | COc1ccc(/C=C\c2cc(C)c(C)c(OC)c2)cc1[NH3+] |
| InChI | InChI=1S/C18H21NO2/c1-12-9-15(11-18(21-4)13(12)2)6-5-14-7-8-17(20-3)16(19)10-14/h5-11H,19H2,1-4H3/p+1/b6-5- |
| InChIKey | KMJVHWHRVPPFLR-WAYWQWQTSA-O |
| XLogP | 3.36 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|