C25H30N2O5 — CID 57380560
methyl 6-[(1S,2R,6S)-1-hydroxy-2-methoxycarbonyl-6-methyloctyl]phenazine-1-carboxylate (PubChem CID 57380560) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is methyl 6-[(1S,2R,6S)-1-hydroxy-2-methoxycarbonyl-6-methyloctyl]phenazine-1-carboxylate.
| Compound Name | methyl 6-[(1S,2R,6S)-1-hydroxy-2-methoxycarbonyl-6-methyloctyl]phenazine-1-carboxylate |
|---|---|
| PubChem CID | 57380560 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | methyl 6-[(1S,2R,6S)-1-hydroxy-2-methoxycarbonyl-6-methyloctyl]phenazine-1-carboxylate |
| SMILES | CC[C@H](C)CCC[C@@H](C(=O)OC)[C@H](O)c1cccc2nc3c(C(=O)OC)cccc3nc12 |
| InChI | InChI=1S/C25H30N2O5/c1-5-15(2)9-6-12-18(25(30)32-4)23(28)16-10-7-13-19-21(16)26-20-14-8-11-17(22(20)27-19)24(29)31-3/h7-8,10-11,13-15,18,23,28H,5-6,9,12H2,1-4H3/t15-,18+,23+/m0/s1 |
| InChIKey | AZOPYQAOEZDMBE-TUVUNVSASA-N |
| XLogP | 4.61 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|