C29H35N3O7S — CID 169492478
(2R)-2-acetamido-3-[(1S,2S)-2-methoxycarbonyl-1-(6-methoxycarbonylphenazin-1-yl)-6-methylheptyl]sulfanylpropanoic acid (PubChem CID 169492478) has the molecular formula C29H35N3O7S and a molecular weight of 569.68 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(1S,2S)-2-methoxycarbonyl-1-(6-methoxycarbonylphenazin-1-yl)-6-methylheptyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(1S,2S)-2-methoxycarbonyl-1-(6-methoxycarbonylphenazin-1-yl)-6-methylheptyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 169492478 |
| Molecular Formula | C29H35N3O7S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | (2R)-2-acetamido-3-[(1S,2S)-2-methoxycarbonyl-1-(6-methoxycarbonylphenazin-1-yl)-6-methylheptyl]sulfanylpropanoic acid |
| SMILES | COC(=O)c1cccc2nc3c([C@@H](SC[C@H](NC(C)=O)C(=O)O)[C@@H](CCCC(C)C)C(=O)OC)cccc3nc12 |
| InChI | InChI=1S/C29H35N3O7S/c1-16(2)9-6-12-20(29(37)39-5)26(40-15-23(27(34)35)30-17(3)33)18-10-7-13-21-24(18)31-22-14-8-11-19(25(22)32-21)28(36)38-4/h7-8,10-11,13-14,16,20,23,26H,6,9,12,15H2,1-5H3,(H,30,33)(H,34,35)/t20-,23+,26-/m1/s1 |
| InChIKey | YLDPDFAIPWIXPA-UVWWXKGLSA-N |
| XLogP | 4.55 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|