C24H28N2O5 — CID 163019140
methyl 6-[(2R,3S)-3-hydroxy-1-methoxy-1-oxononan-2-yl]phenazine-1-carboxylate (PubChem CID 163019140) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is methyl 6-[(2R,3S)-3-hydroxy-1-methoxy-1-oxononan-2-yl]phenazine-1-carboxylate.
| Compound Name | methyl 6-[(2R,3S)-3-hydroxy-1-methoxy-1-oxononan-2-yl]phenazine-1-carboxylate |
|---|---|
| PubChem CID | 163019140 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | methyl 6-[(2R,3S)-3-hydroxy-1-methoxy-1-oxononan-2-yl]phenazine-1-carboxylate |
| SMILES | CCCCCC[C@H](O)[C@H](C(=O)OC)c1cccc2nc3c(C(=O)OC)cccc3nc12 |
| InChI | InChI=1S/C24H28N2O5/c1-4-5-6-7-14-19(27)20(24(29)31-3)15-10-8-12-17-21(15)25-18-13-9-11-16(22(18)26-17)23(28)30-2/h8-13,19-20,27H,4-7,14H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | SOKLNJHTUUKGKZ-VQTJNVASSA-N |
| XLogP | 4.16 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|