C20H20N2O7S — CID 162903189
4-methylsulfanyl-6-[(2S,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenazine-1-carboxylic acid (PubChem CID 162903189) has the molecular formula C20H20N2O7S and a molecular weight of 432.45 g/mol. Its IUPAC name is 4-methylsulfanyl-6-[(2S,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenazine-1-carboxylic acid.
| Compound Name | 4-methylsulfanyl-6-[(2S,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenazine-1-carboxylic acid |
|---|---|
| PubChem CID | 162903189 |
| Molecular Formula | C20H20N2O7S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 4-methylsulfanyl-6-[(2S,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenazine-1-carboxylic acid |
| SMILES | CSc1ccc(C(=O)O)c2nc3cccc(O[C@@H]4OC(C)[C@H](O)C(O)[C@@H]4O)c3nc12 |
| InChI | InChI=1S/C20H20N2O7S/c1-8-16(23)17(24)18(25)20(28-8)29-11-5-3-4-10-14(11)22-15-12(30-2)7-6-9(19(26)27)13(15)21-10/h3-8,16-18,20,23-25H,1-2H3,(H,26,27)/t8?,16-,17?,18-,20-/m0/s1 |
| InChIKey | VGDKDGBMEZJAMP-XQEYMWFJSA-N |
| XLogP | 1.41 |
| TPSA | 142.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|