C14H15NO8 — CID 162816317
8-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,3-benzoxazine-2,4-dione (PubChem CID 162816317) has the molecular formula C14H15NO8 and a molecular weight of 325.27 g/mol. Its IUPAC name is 8-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,3-benzoxazine-2,4-dione.
| Compound Name | 8-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,3-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 162816317 |
| Molecular Formula | C14H15NO8 |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 8-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,3-benzoxazine-2,4-dione |
| SMILES | CC1OC(Oc2cccc3c(=O)[nH]c(=O)oc23)C(O)C(O)C1O |
| InChI | InChI=1S/C14H15NO8/c1-5-8(16)9(17)10(18)13(21-5)22-7-4-2-3-6-11(7)23-14(20)15-12(6)19/h2-5,8-10,13,16-18H,1H3,(H,15,19,20) |
| InChIKey | QUNQJKAHCZXEPZ-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |