C27H23Cl2NO5S — CID 177125370
[(2R,3R,5R)-5-(C-benzylsulfanylcarbonimidoyl)-3-(4-chlorobenzoyl)oxyoxolan-2-yl]methyl 4-chlorobenzoate (PubChem CID 177125370) has the molecular formula C27H23Cl2NO5S and a molecular weight of 544.46 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(C-benzylsulfanylcarbonimidoyl)-3-(4-chlorobenzoyl)oxyoxolan-2-yl]methyl 4-chlorobenzoate.
| Compound Name | [(2R,3R,5R)-5-(C-benzylsulfanylcarbonimidoyl)-3-(4-chlorobenzoyl)oxyoxolan-2-yl]methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 177125370 |
| Molecular Formula | C27H23Cl2NO5S |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | [(2R,3R,5R)-5-(C-benzylsulfanylcarbonimidoyl)-3-(4-chlorobenzoyl)oxyoxolan-2-yl]methyl 4-chlorobenzoate |
| SMILES | [H]/N=C(\SCc1ccccc1)[C@H]1C[C@@H](OC(=O)c2ccc(Cl)cc2)[C@@H](COC(=O)c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C27H23Cl2NO5S/c28-20-10-6-18(7-11-20)26(31)33-15-24-22(35-27(32)19-8-12-21(29)13-9-19)14-23(34-24)25(30)36-16-17-4-2-1-3-5-17/h1-13,22-24,30H,14-16H2/b30-25-/t22-,23-,24-/m1/s1 |
| InChIKey | OOMGAYLWQSXUNB-VHAWMISVSA-N |
| XLogP | 6.44 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|