C14H15ClO5 — CID 170584760
[5-chloro-2-(formyloxymethyl)oxolan-3-yl] 4-methylbenzoate (PubChem CID 170584760) has the molecular formula C14H15ClO5 and a molecular weight of 298.72 g/mol. Its IUPAC name is [5-chloro-2-(formyloxymethyl)oxolan-3-yl] 4-methylbenzoate.
| Compound Name | [5-chloro-2-(formyloxymethyl)oxolan-3-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 170584760 |
| Molecular Formula | C14H15ClO5 |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | [5-chloro-2-(formyloxymethyl)oxolan-3-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC2CC(Cl)OC2COC=O)cc1 |
| InChI | InChI=1S/C14H15ClO5/c1-9-2-4-10(5-3-9)14(17)20-11-6-13(15)19-12(11)7-18-8-16/h2-5,8,11-13H,6-7H2,1H3 |
| InChIKey | ANNOJXQAUOINOR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|