C20H24N4O5 — CID 163265307
tert-butyl 3-[4-(3-amino-4-nitrophenoxy)anilino]azetidine-1-carboxylate (PubChem CID 163265307) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is tert-butyl 3-[4-(3-amino-4-nitrophenoxy)anilino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(3-amino-4-nitrophenoxy)anilino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 163265307 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | tert-butyl 3-[4-(3-amino-4-nitrophenoxy)anilino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Nc2ccc(Oc3ccc([N+](=O)[O-])c(N)c3)cc2)C1 |
| InChI | InChI=1S/C20H24N4O5/c1-20(2,3)29-19(25)23-11-14(12-23)22-13-4-6-15(7-5-13)28-16-8-9-18(24(26)27)17(21)10-16/h4-10,14,22H,11-12,21H2,1-3H3 |
| InChIKey | JYTLADVIKNGJTK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|