C9H18N4O2 — CID 77000498
3-(3,4-dimethylpiperazin-1-yl)-N'-hydroxy-3-oxopropanimidamide (PubChem CID 77000498) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-(3,4-dimethylpiperazin-1-yl)-N'-hydroxy-3-oxopropanimidamide.
| Compound Name | 3-(3,4-dimethylpiperazin-1-yl)-N'-hydroxy-3-oxopropanimidamide |
|---|---|
| PubChem CID | 77000498 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 3-(3,4-dimethylpiperazin-1-yl)-N'-hydroxy-3-oxopropanimidamide |
| SMILES | CC1CN(C(=O)CC(N)=NO)CCN1C |
| InChI | InChI=1S/C9H18N4O2/c1-7-6-13(4-3-12(7)2)9(14)5-8(10)11-15/h7,15H,3-6H2,1-2H3,(H2,10,11) |
| InChIKey | DRCJSIHEONAWQE-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|