C9H17N3O3 — CID 43155988
3-(2,6-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide (PubChem CID 43155988) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide |
|---|---|
| PubChem CID | 43155988 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide |
| SMILES | CC1CN(C(=O)C/C(N)=N/O)CC(C)O1 |
| InChI | InChI=1S/C9H17N3O3/c1-6-4-12(5-7(2)15-6)9(13)3-8(10)11-14/h6-7,14H,3-5H2,1-2H3,(H2,10,11) |
| InChIKey | DCKAFCQKHBLYCJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|