C15H30N4O2 — CID 77000518
2-(3,4-dimethylpiperazine-1-carbonyl)-N'-hydroxy-2-propylpentanimidamide (PubChem CID 77000518) has the molecular formula C15H30N4O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-(3,4-dimethylpiperazine-1-carbonyl)-N'-hydroxy-2-propylpentanimidamide.
| Compound Name | 2-(3,4-dimethylpiperazine-1-carbonyl)-N'-hydroxy-2-propylpentanimidamide |
|---|---|
| PubChem CID | 77000518 |
| Molecular Formula | C15H30N4O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 2-(3,4-dimethylpiperazine-1-carbonyl)-N'-hydroxy-2-propylpentanimidamide |
| SMILES | CCCC(CCC)(C(=O)N1CCN(C)C(C)C1)C(N)=NO |
| InChI | InChI=1S/C15H30N4O2/c1-5-7-15(8-6-2,13(16)17-21)14(20)19-10-9-18(4)12(3)11-19/h12,21H,5-11H2,1-4H3,(H2,16,17) |
| InChIKey | FUYBCOWUQYCPHT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|