C12H27N3S — CID 123416782
3-[4-[ethylidene(methyl)-λ4-sulfanyl]piperazin-1-yl]-N,N-dimethylpropan-1-amine (PubChem CID 123416782) has the molecular formula C12H27N3S and a molecular weight of 245.44 g/mol. Its IUPAC name is 3-[4-[ethylidene(methyl)-λ4-sulfanyl]piperazin-1-yl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-[ethylidene(methyl)-λ4-sulfanyl]piperazin-1-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 123416782 |
| Molecular Formula | C12H27N3S |
| Molecular Weight | 245.44 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 3-[4-[ethylidene(methyl)-λ4-sulfanyl]piperazin-1-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CC=S(C)N1CCN(CCCN(C)C)CC1 |
| InChI | InChI=1S/C12H27N3S/c1-5-16(4)15-11-9-14(10-12-15)8-6-7-13(2)3/h5H,6-12H2,1-4H3 |
| InChIKey | IIZJVRRMCNOOHU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|