C14H30BrN3 — CID 65012025
2-[4-[2-(bromomethyl)-3-methylbutyl]piperazin-1-yl]-N,N-dimethylethanamine (PubChem CID 65012025) has the molecular formula C14H30BrN3 and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-[4-[2-(bromomethyl)-3-methylbutyl]piperazin-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[2-(bromomethyl)-3-methylbutyl]piperazin-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 65012025 |
| Molecular Formula | C14H30BrN3 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-[4-[2-(bromomethyl)-3-methylbutyl]piperazin-1-yl]-N,N-dimethylethanamine |
| SMILES | CC(C)C(CBr)CN1CCN(CCN(C)C)CC1 |
| InChI | InChI=1S/C14H30BrN3/c1-13(2)14(11-15)12-18-9-7-17(8-10-18)6-5-16(3)4/h13-14H,5-12H2,1-4H3 |
| InChIKey | SSDWUOIUIRCDQS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|