C14H29BrN2 — CID 65011735
1-[1-[2-(bromomethyl)-3-methylbutyl]piperidin-4-yl]-N,N-dimethylmethanamine (PubChem CID 65011735) has the molecular formula C14H29BrN2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 1-[1-[2-(bromomethyl)-3-methylbutyl]piperidin-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[1-[2-(bromomethyl)-3-methylbutyl]piperidin-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 65011735 |
| Molecular Formula | C14H29BrN2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-[1-[2-(bromomethyl)-3-methylbutyl]piperidin-4-yl]-N,N-dimethylmethanamine |
| SMILES | CC(C)C(CBr)CN1CCC(CN(C)C)CC1 |
| InChI | InChI=1S/C14H29BrN2/c1-12(2)14(9-15)11-17-7-5-13(6-8-17)10-16(3)4/h12-14H,5-11H2,1-4H3 |
| InChIKey | TYKLVTWAKPRJBW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|