C13H24BrN — CID 115561223
2-[2-(bromomethyl)-3-methylbutyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 115561223) has the molecular formula C13H24BrN and a molecular weight of 274.25 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3-methylbutyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 2-[2-(bromomethyl)-3-methylbutyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 115561223 |
| Molecular Formula | C13H24BrN |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-[2-(bromomethyl)-3-methylbutyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | CC(C)C(CBr)CN1CC2CCCC2C1 |
| InChI | InChI=1S/C13H24BrN/c1-10(2)13(6-14)9-15-7-11-4-3-5-12(11)8-15/h10-13H,3-9H2,1-2H3 |
| InChIKey | AHUBDCMPAUVZMY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|